About 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide
3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide (PubChem CID 44560514) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide.
Molecular Properties
| Compound Name | 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide |
| PubChem CID | 44560514 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide |
| SMILES | C=CCNC(=O)C(C)(C)C(O)CCCCCCC |
| InChI | InChI=1S/C15H29NO2/c1-5-7-8-9-10-11-13(17)15(3,4)14(18)16-12-6-2/h6,13,17H,2,5,7-12H2,1,3-4H3,(H,16,18) |
| InChIKey | MHAHJIOUYCWVQO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide?
The IUPAC name of 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide (CID 44560514) is 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide.
What is the SMILES notation for 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide?
The canonical SMILES for 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide is C=CCNC(=O)C(C)(C)C(O)CCCCCCC.
What is the InChIKey of 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide?
The InChIKey is MHAHJIOUYCWVQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO2/c1-5-7-8-9-10-11-13(17)15(3,4)14(18)16-12-6-2/h6,13,17H,2,5,7-12H2,1,3-4H3,(H,16,18).
What are the key properties of 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide?
3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide has a molecular weight of 255.40 g/mol, XLogP of 3.04, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2-dimethyl-N-prop-2-enyldecanamide is sourced from PubChem (CID 44560514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).