C26H24N2O4 — CID 44560548
benzyl 3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate (PubChem CID 44560548) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is benzyl 3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate.
| Compound Name | benzyl 3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 44560548 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | benzyl 3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazine-7-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN2C(=O)OC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C26H24N2O4/c29-24(31-19-20-10-4-1-5-11-20)27-16-17-28-23(18-27)26(32-25(28)30,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23H,16-19H2 |
| InChIKey | TXBISWLJAOIXMB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |