About (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one
(2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one (PubChem CID 44560551) has the molecular formula C14H19BrN2O
and a molecular weight of 311.22 g/mol. Its IUPAC name is (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one.
Molecular Properties
| Compound Name | (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one |
| PubChem CID | 44560551 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N1Cc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C14H19BrN2O/c1-3-9(2)13(16)14(18)17-7-10-4-5-12(15)6-11(10)8-17/h4-6,9,13H,3,7-8,16H2,1-2H3/t9-,13-/m0/s1 |
| InChIKey | ZENPUNDWTANFFC-ZANVPECISA-N |
| XLogP | 2.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one?
The IUPAC name of (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one (CID 44560551) is (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one.
What is the SMILES notation for (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one?
The canonical SMILES for (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one is CC[C@H](C)[C@H](N)C(=O)N1Cc2ccc(Br)cc2C1.
What is the InChIKey of (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one?
The InChIKey is ZENPUNDWTANFFC-ZANVPECISA-N. The full InChI is InChI=1S/C14H19BrN2O/c1-3-9(2)13(16)14(18)17-7-10-4-5-12(15)6-11(10)8-17/h4-6,9,13H,3,7-8,16H2,1-2H3/t9-,13-/m0/s1.
What are the key properties of (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one?
(2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one has a molecular weight of 311.22 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-amino-1-(5-bromo-1,3-dihydroisoindol-2-yl)-3-methylpentan-1-one is sourced from PubChem (CID 44560551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).