C17H27Cl2N4O3P — CID 44560556
2-(2-aminophenyl)-N-[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]-2-methylpropanamide (PubChem CID 44560556) has the molecular formula C17H27Cl2N4O3P and a molecular weight of 437.31 g/mol. Its IUPAC name is 2-(2-aminophenyl)-N-[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]-2-methylpropanamide.
| Compound Name | 2-(2-aminophenyl)-N-[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 44560556 |
| Molecular Formula | C17H27Cl2N4O3P |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-(2-aminophenyl)-N-[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NC1CCOP(=O)(N(CCCl)CCCl)N1)c1ccccc1N |
| InChI | InChI=1S/C17H27Cl2N4O3P/c1-17(2,13-5-3-4-6-14(13)20)16(24)21-15-7-12-26-27(25,22-15)23(10-8-18)11-9-19/h3-6,15H,7-12,20H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | YGIWOTXYUGIVQV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|