C27H25FN2O3 — CID 44560591
7-[3-(4-fluorophenyl)propanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 44560591) has the molecular formula C27H25FN2O3 and a molecular weight of 444.51 g/mol. Its IUPAC name is 7-[3-(4-fluorophenyl)propanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-[3-(4-fluorophenyl)propanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 44560591 |
| Molecular Formula | C27H25FN2O3 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 7-[3-(4-fluorophenyl)propanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | O=C(CCc1ccc(F)cc1)N1CCN2C(=O)OC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C27H25FN2O3/c28-23-14-11-20(12-15-23)13-16-25(31)29-17-18-30-24(19-29)27(33-26(30)32,21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-12,14-15,24H,13,16-19H2 |
| InChIKey | ZZMCHDUEXCXPDG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |