C27H27N3O3 — CID 44560593
7-[(2R)-2-amino-3-phenylpropanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 44560593) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 7-[(2R)-2-amino-3-phenylpropanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-[(2R)-2-amino-3-phenylpropanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 44560593 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 7-[(2R)-2-amino-3-phenylpropanoyl]-1,1-diphenyl-5,6,8,8a-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | N[C@H](Cc1ccccc1)C(=O)N1CCN2C(=O)OC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C27H27N3O3/c28-23(18-20-10-4-1-5-11-20)25(31)29-16-17-30-24(19-29)27(33-26(30)32,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,23-24H,16-19,28H2/t23-,24?/m1/s1 |
| InChIKey | WSHSOMYIOWSNQH-MIHMCVIASA-N |
| XLogP | 3.16 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |