About 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide
3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide (PubChem CID 44560641) has the molecular formula C23H30N4O2
and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide |
| PubChem CID | 44560641 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(C(=O)NCCCC2CCCCC2)cc1C(=O)Nc1ccc(N)nc1 |
| InChI | InChI=1S/C23H30N4O2/c1-16-9-10-18(22(28)25-13-5-8-17-6-3-2-4-7-17)14-20(16)23(29)27-19-11-12-21(24)26-15-19/h9-12,14-15,17H,2-8,13H2,1H3,(H2,24,26)(H,25,28)(H,27,29) |
| InChIKey | ZGRFFKUUDPFJDU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide?
The IUPAC name of 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide (CID 44560641) is 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide.
What is the SMILES notation for 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide?
The canonical SMILES for 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide is Cc1ccc(C(=O)NCCCC2CCCCC2)cc1C(=O)Nc1ccc(N)nc1.
What is the InChIKey of 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide?
The InChIKey is ZGRFFKUUDPFJDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N4O2/c1-16-9-10-18(22(28)25-13-5-8-17-6-3-2-4-7-17)14-20(16)23(29)27-19-11-12-21(24)26-15-19/h9-12,14-15,17H,2-8,13H2,1H3,(H2,24,26)(H,25,28)(H,27,29).
What are the key properties of 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide?
3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide has a molecular weight of 394.52 g/mol, XLogP of 4.31, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(6-amino-3-pyridinyl)-1-N-(3-cyclohexylpropyl)-4-methylbenzene-1,3-dicarboxamide is sourced from PubChem (CID 44560641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).