C17H22N4O3S — CID 44560771
2-(carbamoylamino)-5-[4-[3-(dimethylamino)propoxy]phenyl]thiophene-3-carboxamide (PubChem CID 44560771) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[4-[3-(dimethylamino)propoxy]phenyl]thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[4-[3-(dimethylamino)propoxy]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 44560771 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-(carbamoylamino)-5-[4-[3-(dimethylamino)propoxy]phenyl]thiophene-3-carboxamide |
| SMILES | CN(C)CCCOc1ccc(-c2cc(C(N)=O)c(NC(N)=O)s2)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-21(2)8-3-9-24-12-6-4-11(5-7-12)14-10-13(15(18)22)16(25-14)20-17(19)23/h4-7,10H,3,8-9H2,1-2H3,(H2,18,22)(H3,19,20,23) |
| InChIKey | MKFBFGXYGIKOGL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|