About (3S)-1,7-diphenylheptan-3-ol
(3S)-1,7-diphenylheptan-3-ol (PubChem CID 44560925) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is (3S)-1,7-diphenylheptan-3-ol.
Molecular Properties
| Compound Name | (3S)-1,7-diphenylheptan-3-ol |
| PubChem CID | 44560925 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (3S)-1,7-diphenylheptan-3-ol |
| SMILES | O[C@@H](CCCCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H24O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-6,9-12,19-20H,7-8,13-16H2/t19-/m0/s1 |
| InChIKey | FITFAFMCWGCVDQ-IBGZPJMESA-N |
| XLogP | 4.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1,7-diphenylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,7-diphenylheptan-3-ol?
The IUPAC name of (3S)-1,7-diphenylheptan-3-ol (CID 44560925) is (3S)-1,7-diphenylheptan-3-ol.
What is the SMILES notation for (3S)-1,7-diphenylheptan-3-ol?
The canonical SMILES for (3S)-1,7-diphenylheptan-3-ol is O[C@@H](CCCCc1ccccc1)CCc1ccccc1.
What is the InChIKey of (3S)-1,7-diphenylheptan-3-ol?
The InChIKey is FITFAFMCWGCVDQ-IBGZPJMESA-N. The full InChI is InChI=1S/C19H24O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-6,9-12,19-20H,7-8,13-16H2/t19-/m0/s1.
What are the key properties of (3S)-1,7-diphenylheptan-3-ol?
(3S)-1,7-diphenylheptan-3-ol has a molecular weight of 268.40 g/mol, XLogP of 4.39, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,7-diphenylheptan-3-ol is sourced from PubChem (CID 44560925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).