C24H38F3N5O5 — CID 44560940
(1R,2S,5S)-N-(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 44560940) has the molecular formula C24H38F3N5O5 and a molecular weight of 533.59 g/mol. Its IUPAC name is (1R,2S,5S)-N-(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 44560940 |
| Molecular Formula | C24H38F3N5O5 |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | (1R,2S,5S)-N-(5-amino-1,1,1-trifluoro-4,5-dioxopentan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(CC(F)(F)F)C(=O)C(N)=O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H38F3N5O5/c1-21(2,3)16(30-20(37)31-22(4,5)6)19(36)32-10-11-13(23(11,7)8)14(32)18(35)29-12(9-24(25,26)27)15(33)17(28)34/h11-14,16H,9-10H2,1-8H3,(H2,28,34)(H,29,35)(H2,30,31,37)/t11-,12?,13-,14-,16+/m0/s1 |
| InChIKey | KGZIMQZNIAOLOL-CAWYOGTCSA-N |
| XLogP | 1.47 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|