C25H41F2N5O5 — CID 44560942
(1R,2S,5S)-N-(1-amino-5,5-difluoro-1,2-dioxohexan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 44560942) has the molecular formula C25H41F2N5O5 and a molecular weight of 529.63 g/mol. Its IUPAC name is (1R,2S,5S)-N-(1-amino-5,5-difluoro-1,2-dioxohexan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(1-amino-5,5-difluoro-1,2-dioxohexan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 44560942 |
| Molecular Formula | C25H41F2N5O5 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | (1R,2S,5S)-N-(1-amino-5,5-difluoro-1,2-dioxohexan-3-yl)-3-[(2S)-2-(tert-butylcarbamoylamino)-3,3-dimethylbutanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(F)(F)CC(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)NC(C)(C)C)C(C)(C)C)C2(C)C)C(=O)C(N)=O |
| InChI | InChI=1S/C25H41F2N5O5/c1-22(2,3)17(30-21(37)31-23(4,5)6)20(36)32-11-12-14(24(12,7)8)15(32)19(35)29-13(10-25(9,26)27)16(33)18(28)34/h12-15,17H,10-11H2,1-9H3,(H2,28,34)(H,29,35)(H2,30,31,37)/t12-,13?,14-,15-,17+/m0/s1 |
| InChIKey | ZMMMAVQQRSPPOG-YGPWJVBQSA-N |
| XLogP | 1.57 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|