About 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea
1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea (PubChem CID 44560958) has the molecular formula C5H12N4O3
and a molecular weight of 176.18 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea.
Molecular Properties
| Compound Name | 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea |
| PubChem CID | 44560958 |
| Molecular Formula | C5H12N4O3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea |
| SMILES | NC(N)=NC(=O)NC[C@H](O)CO |
| InChI | InChI=1S/C5H12N4O3/c6-4(7)9-5(12)8-1-3(11)2-10/h3,10-11H,1-2H2,(H5,6,7,8,9,12)/t3-/m0/s1 |
| InChIKey | WPWWGHQLFQQZHT-VKHMYHEASA-N |
| XLogP | -2.68 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea?
The IUPAC name of 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea (CID 44560958) is 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea.
What is the SMILES notation for 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea?
The canonical SMILES for 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea is NC(N)=NC(=O)NC[C@H](O)CO.
What is the InChIKey of 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea?
The InChIKey is WPWWGHQLFQQZHT-VKHMYHEASA-N. The full InChI is InChI=1S/C5H12N4O3/c6-4(7)9-5(12)8-1-3(11)2-10/h3,10-11H,1-2H2,(H5,6,7,8,9,12)/t3-/m0/s1.
What are the key properties of 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea?
1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea has a molecular weight of 176.18 g/mol, XLogP of -2.68, 3 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diaminomethylidene)-3-[(2S)-2,3-dihydroxypropyl]urea is sourced from PubChem (CID 44560958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).