C21H20N4O3 — CID 44560970
pyridin-3-ylmethyl 2-[4-[(2-aminophenyl)carbamoyl]anilino]acetate (PubChem CID 44560970) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-[4-[(2-aminophenyl)carbamoyl]anilino]acetate.
| Compound Name | pyridin-3-ylmethyl 2-[4-[(2-aminophenyl)carbamoyl]anilino]acetate |
|---|---|
| PubChem CID | 44560970 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | pyridin-3-ylmethyl 2-[4-[(2-aminophenyl)carbamoyl]anilino]acetate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NCC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H20N4O3/c22-18-5-1-2-6-19(18)25-21(27)16-7-9-17(10-8-16)24-13-20(26)28-14-15-4-3-11-23-12-15/h1-12,24H,13-14,22H2,(H,25,27) |
| InChIKey | TVMRSZYLJBAPSH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|