C17H20N4O — CID 44560999
3-[[[amino-(2-phenylethylamino)methylidene]amino]methyl]benzamide (PubChem CID 44560999) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[[[amino-(2-phenylethylamino)methylidene]amino]methyl]benzamide.
| Compound Name | 3-[[[amino-(2-phenylethylamino)methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 44560999 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-[[[amino-(2-phenylethylamino)methylidene]amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(C/N=C(\N)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C17H20N4O/c18-16(22)15-8-4-7-14(11-15)12-21-17(19)20-10-9-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H2,18,22)(H3,19,20,21) |
| InChIKey | ZPNQGPOLAAHEQQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|