C18H14Cl2F3N3O — CID 44561154
(2R,3R)-3-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine (PubChem CID 44561154) has the molecular formula C18H14Cl2F3N3O and a molecular weight of 416.23 g/mol. Its IUPAC name is (2R,3R)-3-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine.
| Compound Name | (2R,3R)-3-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 44561154 |
| Molecular Formula | C18H14Cl2F3N3O |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (2R,3R)-3-[3-(2,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine |
| SMILES | C[C@@H](c1nc(-c2ccc(Cl)cc2Cl)no1)[C@H](N)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H14Cl2F3N3O/c1-8(16(24)5-9-4-14(22)15(23)7-13(9)21)18-25-17(26-27-18)11-3-2-10(19)6-12(11)20/h2-4,6-8,16H,5,24H2,1H3/t8-,16-/m1/s1 |
| InChIKey | DWQWDMKZORYMTF-VPTHRUTESA-N |
| XLogP | 5.13 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|