C22H21F3N6O2 — CID 44561163
2-(4-morpholin-4-ylanilino)-4-[(2,4,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide (PubChem CID 44561163) has the molecular formula C22H21F3N6O2 and a molecular weight of 458.44 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylanilino)-4-[(2,4,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-morpholin-4-ylanilino)-4-[(2,4,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 44561163 |
| Molecular Formula | C22H21F3N6O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-(4-morpholin-4-ylanilino)-4-[(2,4,6-trifluorophenyl)methylamino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(Nc2ccc(N3CCOCC3)cc2)nc1NCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C22H21F3N6O2/c23-13-9-18(24)16(19(25)10-13)11-27-21-17(20(26)32)12-28-22(30-21)29-14-1-3-15(4-2-14)31-5-7-33-8-6-31/h1-4,9-10,12H,5-8,11H2,(H2,26,32)(H2,27,28,29,30) |
| InChIKey | REUWMZJCJWNNNQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|