About (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one
(3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one (PubChem CID 44561191) has the molecular formula C15H26N4O3
and a molecular weight of 310.40 g/mol. Its IUPAC name is (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one |
| PubChem CID | 44561191 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one |
| SMILES | C[C@@H]1C(=O)NCCCN1C(=O)C[C@H](N)CN1CCCCC1=O |
| InChI | InChI=1S/C15H26N4O3/c1-11-15(22)17-6-4-8-19(11)14(21)9-12(16)10-18-7-3-2-5-13(18)20/h11-12H,2-10,16H2,1H3,(H,17,22)/t11-,12+/m1/s1 |
| InChIKey | GDZNXYMPHWIXDM-NEPJUHHUSA-N |
| XLogP | -0.55 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one?
The IUPAC name of (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one (CID 44561191) is (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one.
What is the SMILES notation for (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one?
The canonical SMILES for (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one is C[C@@H]1C(=O)NCCCN1C(=O)C[C@H](N)CN1CCCCC1=O.
What is the InChIKey of (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one?
The InChIKey is GDZNXYMPHWIXDM-NEPJUHHUSA-N. The full InChI is InChI=1S/C15H26N4O3/c1-11-15(22)17-6-4-8-19(11)14(21)9-12(16)10-18-7-3-2-5-13(18)20/h11-12H,2-10,16H2,1H3,(H,17,22)/t11-,12+/m1/s1.
What are the key properties of (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one?
(3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one has a molecular weight of 310.40 g/mol, XLogP of -0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-[(3S)-3-amino-4-(2-oxopiperidin-1-yl)butanoyl]-3-methyl-1,4-diazepan-2-one is sourced from PubChem (CID 44561191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).