C28H37NO2 — CID 44561229
(2E,4E,6E,8E)-N-[4-(2-hydroxyethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 44561229) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-[4-(2-hydroxyethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-[4-(2-hydroxyethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 44561229 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | (2E,4E,6E,8E)-N-[4-(2-hydroxyethyl)phenyl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2ccc(CCO)cc2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H37NO2/c1-21(11-16-26-23(3)10-7-18-28(26,4)5)8-6-9-22(2)20-27(31)29-25-14-12-24(13-15-25)17-19-30/h6,8-9,11-16,20,30H,7,10,17-19H2,1-5H3,(H,29,31)/b9-6+,16-11+,21-8+,22-20+ |
| InChIKey | QGDCEVRAXKKNGL-OHEFLVKWSA-N |
| XLogP | 6.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|