C9H11NS — CID 44561253
(1S,5R)-1-thiophen-3-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 44561253) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is (1S,5R)-1-thiophen-3-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-1-thiophen-3-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 44561253 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (1S,5R)-1-thiophen-3-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | c1cc([C@@]23CNC[C@@H]2C3)cs1 |
| InChI | InChI=1S/C9H11NS/c1-2-11-5-7(1)9-3-8(9)4-10-6-9/h1-2,5,8,10H,3-4,6H2/t8-,9+/m0/s1 |
| InChIKey | PGFKJKVDCBANAD-DTWKUNHWSA-N |
| XLogP | 1.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |