C25H37N5O — CID 44561334
N-cycloheptyl-7-methoxy-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-4-amine (PubChem CID 44561334) has the molecular formula C25H37N5O and a molecular weight of 423.61 g/mol. Its IUPAC name is N-cycloheptyl-7-methoxy-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-4-amine.
| Compound Name | N-cycloheptyl-7-methoxy-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 44561334 |
| Molecular Formula | C25H37N5O |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | N-cycloheptyl-7-methoxy-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinazolin-4-amine |
| SMILES | COc1ccc2c(NC3CCCCCC3)nc(N3CCC(N4CCCC4)CC3)nc2c1 |
| InChI | InChI=1S/C25H37N5O/c1-31-21-10-11-22-23(18-21)27-25(28-24(22)26-19-8-4-2-3-5-9-19)30-16-12-20(13-17-30)29-14-6-7-15-29/h10-11,18-20H,2-9,12-17H2,1H3,(H,26,27,28) |
| InChIKey | DZSXOSFSUGNQQK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |