C20H35NO — CID 44561417
(2E,4E)-5,9-dimethyl-N-octyldeca-2,4,8-trienamide (PubChem CID 44561417) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is (2E,4E)-5,9-dimethyl-N-octyldeca-2,4,8-trienamide.
| Compound Name | (2E,4E)-5,9-dimethyl-N-octyldeca-2,4,8-trienamide |
|---|---|
| PubChem CID | 44561417 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | (2E,4E)-5,9-dimethyl-N-octyldeca-2,4,8-trienamide |
| SMILES | CCCCCCCCNC(=O)/C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H35NO/c1-5-6-7-8-9-10-17-21-20(22)16-12-15-19(4)14-11-13-18(2)3/h12-13,15-16H,5-11,14,17H2,1-4H3,(H,21,22)/b16-12+,19-15+ |
| InChIKey | FLHRPNBBSAXUED-KATGWBAQSA-N |
| XLogP | 5.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|