C16H27NO — CID 44561470
(2E,4E)-5,9-dimethyl-N-(2-methylpropyl)deca-2,4,8-trienamide (PubChem CID 44561470) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (2E,4E)-5,9-dimethyl-N-(2-methylpropyl)deca-2,4,8-trienamide.
| Compound Name | (2E,4E)-5,9-dimethyl-N-(2-methylpropyl)deca-2,4,8-trienamide |
|---|---|
| PubChem CID | 44561470 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (2E,4E)-5,9-dimethyl-N-(2-methylpropyl)deca-2,4,8-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C16H27NO/c1-13(2)8-6-9-15(5)10-7-11-16(18)17-12-14(3)4/h7-8,10-11,14H,6,9,12H2,1-5H3,(H,17,18)/b11-7+,15-10+ |
| InChIKey | SGMSVLHOUINMKF-HTYBMYLDSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|