C18H29NO2 — CID 44561548
(2E,4E,8E)-5,9-dimethyl-10-oxo-N,N-di(propan-2-yl)deca-2,4,8-trienamide (PubChem CID 44561548) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2E,4E,8E)-5,9-dimethyl-10-oxo-N,N-di(propan-2-yl)deca-2,4,8-trienamide.
| Compound Name | (2E,4E,8E)-5,9-dimethyl-10-oxo-N,N-di(propan-2-yl)deca-2,4,8-trienamide |
|---|---|
| PubChem CID | 44561548 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2E,4E,8E)-5,9-dimethyl-10-oxo-N,N-di(propan-2-yl)deca-2,4,8-trienamide |
| SMILES | C/C(C=O)=C\CC/C(C)=C/C=C/C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C18H29NO2/c1-14(2)19(15(3)4)18(21)12-8-10-16(5)9-7-11-17(6)13-20/h8,10-15H,7,9H2,1-6H3/b12-8+,16-10+,17-11+ |
| InChIKey | LAXVRCZIWYRAKL-GDIAMCNSSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|