C21H26O5 — CID 44561635
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(3-methylphenyl)ethyl]phenyl]oxane-3,4,5-triol (PubChem CID 44561635) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(3-methylphenyl)ethyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(3-methylphenyl)ethyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 44561635 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[2-(3-methylphenyl)ethyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1cccc(CCc2cccc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)c2)c1 |
| InChI | InChI=1S/C21H26O5/c1-13-4-2-5-14(10-13)8-9-15-6-3-7-16(11-15)21-20(25)19(24)18(23)17(12-22)26-21/h2-7,10-11,17-25H,8-9,12H2,1H3/t17-,18-,19+,20?,21+/m1/s1 |
| InChIKey | APWXGJKLDJIIKV-BKUVARHGSA-N |
| XLogP | 1.30 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |