C21H23NO2 — CID 44561636
4-[(1S,3aR,8aR,8bR)-5,5,8a-trimethyl-3-oxo-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-1-yl]benzonitrile (PubChem CID 44561636) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-[(1S,3aR,8aR,8bR)-5,5,8a-trimethyl-3-oxo-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-1-yl]benzonitrile.
| Compound Name | 4-[(1S,3aR,8aR,8bR)-5,5,8a-trimethyl-3-oxo-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-1-yl]benzonitrile |
|---|---|
| PubChem CID | 44561636 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 4-[(1S,3aR,8aR,8bR)-5,5,8a-trimethyl-3-oxo-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-1-yl]benzonitrile |
| SMILES | CC1(C)CCC[C@@]2(C)C1=C[C@H]1C(=O)O[C@H](c3ccc(C#N)cc3)[C@H]12 |
| InChI | InChI=1S/C21H23NO2/c1-20(2)9-4-10-21(3)16(20)11-15-17(21)18(24-19(15)23)14-7-5-13(12-22)6-8-14/h5-8,11,15,17-18H,4,9-10H2,1-3H3/t15-,17+,18-,21+/m1/s1 |
| InChIKey | SKHUYGCIVXPHRJ-HVSHLEFESA-N |
| XLogP | 4.54 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|