C12H13N3O5S — CID 44561646
N,N-dimethyl-2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)sulfonyl]acetamide (PubChem CID 44561646) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)sulfonyl]acetamide.
| Compound Name | N,N-dimethyl-2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)sulfonyl]acetamide |
|---|---|
| PubChem CID | 44561646 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N,N-dimethyl-2-[(2-oxido-4-phenyl-1,2,5-oxadiazol-2-ium-3-yl)sulfonyl]acetamide |
| SMILES | CN(C)C(=O)CS(=O)(=O)c1c(-c2ccccc2)no[n+]1[O-] |
| InChI | InChI=1S/C12H13N3O5S/c1-14(2)10(16)8-21(18,19)12-11(13-20-15(12)17)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | JNKLQZPFTGPCRX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 107.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|