C20H23FO2 — CID 44561724
(1S,3aR,8aR,8bR)-1-(4-fluorophenyl)-5,5,8a-trimethyl-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one (PubChem CID 44561724) has the molecular formula C20H23FO2 and a molecular weight of 314.40 g/mol. Its IUPAC name is (1S,3aR,8aR,8bR)-1-(4-fluorophenyl)-5,5,8a-trimethyl-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one.
| Compound Name | (1S,3aR,8aR,8bR)-1-(4-fluorophenyl)-5,5,8a-trimethyl-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one |
|---|---|
| PubChem CID | 44561724 |
| Molecular Formula | C20H23FO2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1S,3aR,8aR,8bR)-1-(4-fluorophenyl)-5,5,8a-trimethyl-1,3a,6,7,8,8b-hexahydroindeno[1,2-c]furan-3-one |
| SMILES | CC1(C)CCC[C@@]2(C)C1=C[C@H]1C(=O)O[C@H](c3ccc(F)cc3)[C@H]12 |
| InChI | InChI=1S/C20H23FO2/c1-19(2)9-4-10-20(3)15(19)11-14-16(20)17(23-18(14)22)12-5-7-13(21)8-6-12/h5-8,11,14,16-17H,4,9-10H2,1-3H3/t14-,16+,17-,20+/m1/s1 |
| InChIKey | NKKUEIFRKHGZLD-ASKNOMKYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|