About [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate
[(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate (PubChem CID 44561802) has the molecular formula C23H24O5
and a molecular weight of 380.44 g/mol. Its IUPAC name is [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate.
Molecular Properties
| Compound Name | [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate |
| PubChem CID | 44561802 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCC2(CO)C/C(=C/c3ccccc3)C(=O)O2)c(C)c1 |
| InChI | InChI=1S/C23H24O5/c1-15-9-16(2)20(17(3)10-15)22(26)27-14-23(13-24)12-19(21(25)28-23)11-18-7-5-4-6-8-18/h4-11,24H,12-14H2,1-3H3/b19-11- |
| InChIKey | HNQBTOFUFYMRCC-ODLFYWEKSA-N |
| XLogP | 3.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate?
The IUPAC name of [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate (CID 44561802) is [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate.
What is the SMILES notation for [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate?
The canonical SMILES for [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate is Cc1cc(C)c(C(=O)OCC2(CO)C/C(=C/c3ccccc3)C(=O)O2)c(C)c1.
What is the InChIKey of [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate?
The InChIKey is HNQBTOFUFYMRCC-ODLFYWEKSA-N. The full InChI is InChI=1S/C23H24O5/c1-15-9-16(2)20(17(3)10-15)22(26)27-14-23(13-24)12-19(21(25)28-23)11-18-7-5-4-6-8-18/h4-11,24H,12-14H2,1-3H3/b19-11-.
What are the key properties of [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate?
[(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate has a molecular weight of 380.44 g/mol, XLogP of 3.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-4-benzylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,4,6-trimethylbenzoate is sourced from PubChem (CID 44561802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).