C15H12N2O2S — CID 44561852
4-(4-Methylanilino)thieno[2,3-b]pyridine-5-carboxylic acid (PubChem CID 44561852) has the molecular formula C15H12N2O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-(4-methylanilino)thieno[2,3-b]pyridine-5-carboxylic acid.
| Compound Name | 4-(4-Methylanilino)thieno[2,3-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 44561852 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-(4-methylanilino)thieno[2,3-b]pyridine-5-carboxylic acid |
| SMILES | CC1=CC=C(C=C1)NC2=C3C=CSC3=NC=C2C(=O)O |
| InChI | InChI=1S/C15H12N2O2S/c1-9-2-4-10(5-3-9)17-13-11-6-7-20-14(11)16-8-12(13)15(18)19/h2-8H,1H3,(H,16,17)(H,18,19) |
| InChIKey | CPWMUUSDGOHRHV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 358 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |