C13H17N3O4S — CID 44561901
3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 44561901) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 44561901 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-[[4-(benzenesulfonyl)-1,2,5-oxadiazol-3-yl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1nonc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17N3O4S/c1-16(2)9-6-10-19-12-13(15-20-14-12)21(17,18)11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3 |
| InChIKey | DCAPLNSLQYFELZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|