About 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole
3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole (PubChem CID 44561902) has the molecular formula C14H13N5O6S
and a molecular weight of 379.35 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole |
| PubChem CID | 44561902 |
| Molecular Formula | C14H13N5O6S |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOc1nonc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13N5O6S/c1-10-15-9-12(19(20)21)18(10)7-8-24-13-14(17-25-16-13)26(22,23)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | ZUTZBVMMFDMKKL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 143.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole?
The IUPAC name of 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole (CID 44561902) is 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole.
What is the SMILES notation for 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole?
The canonical SMILES for 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole is Cc1ncc([N+](=O)[O-])n1CCOc1nonc1S(=O)(=O)c1ccccc1.
What is the InChIKey of 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole?
The InChIKey is ZUTZBVMMFDMKKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5O6S/c1-10-15-9-12(19(20)21)18(10)7-8-24-13-14(17-25-16-13)26(22,23)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3.
What are the key properties of 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole?
3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole has a molecular weight of 379.35 g/mol, XLogP of 1.39, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethoxy]-1,2,5-oxadiazole is sourced from PubChem (CID 44561902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).