About [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate
[(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate (PubChem CID 44562107) has the molecular formula C23H23FO5
and a molecular weight of 398.43 g/mol. Its IUPAC name is [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate.
Molecular Properties
| Compound Name | [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate |
| PubChem CID | 44562107 |
| Molecular Formula | C23H23FO5 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCC1(CO)C/C(=C/c2ccc(F)cc2)C(=O)O1)c1ccccc1 |
| InChI | InChI=1S/C23H23FO5/c1-2-20(17-6-4-3-5-7-17)22(27)28-15-23(14-25)13-18(21(26)29-23)12-16-8-10-19(24)11-9-16/h3-12,20,25H,2,13-15H2,1H3/b18-12- |
| InChIKey | UDKRZRADQHUSKA-PDGQHHTCSA-N |
| XLogP | 3.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate?
The IUPAC name of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate (CID 44562107) is [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate.
What is the SMILES notation for [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate?
The canonical SMILES for [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate is CCC(C(=O)OCC1(CO)C/C(=C/c2ccc(F)cc2)C(=O)O1)c1ccccc1.
What is the InChIKey of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate?
The InChIKey is UDKRZRADQHUSKA-PDGQHHTCSA-N. The full InChI is InChI=1S/C23H23FO5/c1-2-20(17-6-4-3-5-7-17)22(27)28-15-23(14-25)13-18(21(26)29-23)12-16-8-10-19(24)11-9-16/h3-12,20,25H,2,13-15H2,1H3/b18-12-.
What are the key properties of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate?
[(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate has a molecular weight of 398.43 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-phenylbutanoate is sourced from PubChem (CID 44562107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).