About [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate
[(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate (PubChem CID 44562203) has the molecular formula C27H23FO5
and a molecular weight of 446.47 g/mol. Its IUPAC name is [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate.
Molecular Properties
| Compound Name | [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate |
| PubChem CID | 44562203 |
| Molecular Formula | C27H23FO5 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate |
| SMILES | O=C1OC(CO)(COC(=O)C(c2ccccc2)c2ccccc2)C/C1=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23FO5/c28-23-13-11-19(12-14-23)15-22-16-27(17-29,33-25(22)30)18-32-26(31)24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-15,24,29H,16-18H2/b22-15- |
| InChIKey | XWZKCHULRCHLKY-JCMHNJIXSA-N |
| XLogP | 4.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate?
The IUPAC name of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate (CID 44562203) is [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate.
What is the SMILES notation for [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate?
The canonical SMILES for [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate is O=C1OC(CO)(COC(=O)C(c2ccccc2)c2ccccc2)C/C1=C/c1ccc(F)cc1.
What is the InChIKey of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate?
The InChIKey is XWZKCHULRCHLKY-JCMHNJIXSA-N. The full InChI is InChI=1S/C27H23FO5/c28-23-13-11-19(12-14-23)15-22-16-27(17-29,33-25(22)30)18-32-26(31)24(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-15,24,29H,16-18H2/b22-15-.
What are the key properties of [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate?
[(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate has a molecular weight of 446.47 g/mol, XLogP of 4.26, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-4-[(4-fluorophenyl)methylidene]-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2,2-diphenylacetate is sourced from PubChem (CID 44562203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).