C17H24N2 — CID 44562320
3,4-dimethyl-8b-(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 44562320) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3,4-dimethyl-8b-(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | 3,4-dimethyl-8b-(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 44562320 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3,4-dimethyl-8b-(3-methylbut-2-enyl)-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | CC(C)=CCC12CCN(C)C1N(C)c1ccccc12 |
| InChI | InChI=1S/C17H24N2/c1-13(2)9-10-17-11-12-18(3)16(17)19(4)15-8-6-5-7-14(15)17/h5-9,16H,10-12H2,1-4H3 |
| InChIKey | VVQNAOIMJGPEFR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|