About N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine
N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine (PubChem CID 44562325) has the molecular formula C23H26N4O3
and a molecular weight of 406.49 g/mol. Its IUPAC name is N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine.
Molecular Properties
| Compound Name | N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine |
| PubChem CID | 44562325 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine |
| SMILES | CCCCNc1nn(C)c2cc(Oc3ccnc4cc(OC)c(OC)cc34)ccc12 |
| InChI | InChI=1S/C23H26N4O3/c1-5-6-10-25-23-16-8-7-15(12-19(16)27(2)26-23)30-20-9-11-24-18-14-22(29-4)21(28-3)13-17(18)20/h7-9,11-14H,5-6,10H2,1-4H3,(H,25,26) |
| InChIKey | OCOSYFAWILUPTE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine?
The IUPAC name of N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine (CID 44562325) is N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine.
What is the SMILES notation for N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine?
The canonical SMILES for N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine is CCCCNc1nn(C)c2cc(Oc3ccnc4cc(OC)c(OC)cc34)ccc12.
What is the InChIKey of N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine?
The InChIKey is OCOSYFAWILUPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O3/c1-5-6-10-25-23-16-8-7-15(12-19(16)27(2)26-23)30-20-9-11-24-18-14-22(29-4)21(28-3)13-17(18)20/h7-9,11-14H,5-6,10H2,1-4H3,(H,25,26).
What are the key properties of N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine?
N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine has a molecular weight of 406.49 g/mol, XLogP of 5.14, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-(6,7-dimethoxyquinolin-4-yl)oxy-1-methylindazol-3-amine is sourced from PubChem (CID 44562325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).