About 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one
8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one (PubChem CID 44562385) has the molecular formula C21H18N2O3S
and a molecular weight of 378.45 g/mol. Its IUPAC name is 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one.
Molecular Properties
| Compound Name | 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one |
| PubChem CID | 44562385 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one |
| SMILES | O=c1cc(N2CCCCC2)oc2c(-c3ncc(-c4ccoc4)s3)cccc12 |
| InChI | InChI=1S/C21H18N2O3S/c24-17-11-19(23-8-2-1-3-9-23)26-20-15(17)5-4-6-16(20)21-22-12-18(27-21)14-7-10-25-13-14/h4-7,10-13H,1-3,8-9H2 |
| InChIKey | TYPBSMXVBQZPNN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one?
The IUPAC name of 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one (CID 44562385) is 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one.
What is the SMILES notation for 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one?
The canonical SMILES for 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one is O=c1cc(N2CCCCC2)oc2c(-c3ncc(-c4ccoc4)s3)cccc12.
What is the InChIKey of 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one?
The InChIKey is TYPBSMXVBQZPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O3S/c24-17-11-19(23-8-2-1-3-9-23)26-20-15(17)5-4-6-16(20)21-22-12-18(27-21)14-7-10-25-13-14/h4-7,10-13H,1-3,8-9H2.
What are the key properties of 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one?
8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one has a molecular weight of 378.45 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[5-(furan-3-yl)-1,3-thiazol-2-yl]-2-piperidin-1-ylchromen-4-one is sourced from PubChem (CID 44562385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).