C20H21NO4 — CID 44562515
(1E,4Z,6E)-7-[4-(dimethylamino)phenyl]-5-hydroxy-1-[5-(hydroxymethyl)furan-2-yl]hepta-1,4,6-trien-3-one (PubChem CID 44562515) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (1E,4Z,6E)-7-[4-(dimethylamino)phenyl]-5-hydroxy-1-[5-(hydroxymethyl)furan-2-yl]hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-7-[4-(dimethylamino)phenyl]-5-hydroxy-1-[5-(hydroxymethyl)furan-2-yl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 44562515 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (1E,4Z,6E)-7-[4-(dimethylamino)phenyl]-5-hydroxy-1-[5-(hydroxymethyl)furan-2-yl]hepta-1,4,6-trien-3-one |
| SMILES | CN(C)c1ccc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(CO)o2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-21(2)16-6-3-15(4-7-16)5-8-17(23)13-18(24)9-10-19-11-12-20(14-22)25-19/h3-13,22-23H,14H2,1-2H3/b8-5+,10-9+,17-13- |
| InChIKey | KBVLRLOKMHYDRM-KWEWJOSESA-N |
| XLogP | 3.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|