About 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid
3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid (PubChem CID 44562640) has the molecular formula C13H12O6S
and a molecular weight of 296.30 g/mol. Its IUPAC name is 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid.
Molecular Properties
| Compound Name | 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid |
| PubChem CID | 44562640 |
| Molecular Formula | C13H12O6S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C13H12O6S/c14-10-7-11(20(18,19)6-5-12(15)16)13(17)9-4-2-1-3-8(9)10/h1-4,7,14,17H,5-6H2,(H,15,16) |
| InChIKey | AEEJSZCMSYRVSK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid?
The IUPAC name of 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid (CID 44562640) is 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid.
What is the SMILES notation for 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid?
The canonical SMILES for 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid is O=C(O)CCS(=O)(=O)c1cc(O)c2ccccc2c1O.
What is the InChIKey of 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid?
The InChIKey is AEEJSZCMSYRVSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O6S/c14-10-7-11(20(18,19)6-5-12(15)16)13(17)9-4-2-1-3-8(9)10/h1-4,7,14,17H,5-6H2,(H,15,16).
What are the key properties of 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid?
3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid has a molecular weight of 296.30 g/mol, XLogP of 1.50, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-dihydroxynaphthalen-2-yl)sulfonylpropanoic acid is sourced from PubChem (CID 44562640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).