About 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine
4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine (PubChem CID 44562686) has the molecular formula C20H16FN5O
and a molecular weight of 361.38 g/mol. Its IUPAC name is 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine |
| PubChem CID | 44562686 |
| Molecular Formula | C20H16FN5O |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2ccc3nc(C4COc5ccc(F)cc5C4)[nH]c3c2)n1 |
| InChI | InChI=1S/C20H16FN5O/c21-14-2-4-18-12(8-14)7-13(10-27-18)19-24-16-3-1-11(9-17(16)25-19)15-5-6-23-20(22)26-15/h1-6,8-9,13H,7,10H2,(H,24,25)(H2,22,23,26) |
| InChIKey | KNHSCMMTXLGHKZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
The IUPAC name of 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine (CID 44562686) is 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine is Nc1nccc(-c2ccc3nc(C4COc5ccc(F)cc5C4)[nH]c3c2)n1.
What is the InChIKey of 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
The InChIKey is KNHSCMMTXLGHKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN5O/c21-14-2-4-18-12(8-14)7-13(10-27-18)19-24-16-3-1-11(9-17(16)25-19)15-5-6-23-20(22)26-15/h1-6,8-9,13H,7,10H2,(H,24,25)(H2,22,23,26).
What are the key properties of 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine?
4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine has a molecular weight of 361.38 g/mol, XLogP of 3.46, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-3H-benzimidazol-5-yl]pyrimidin-2-amine is sourced from PubChem (CID 44562686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).