C15H28O3 — CID 44562720
3-(3,8-dimethyl-1,2-dioxaspiro[4.5]decan-3-yl)-2,2-dimethylpropan-1-ol (PubChem CID 44562720) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-(3,8-dimethyl-1,2-dioxaspiro[4.5]decan-3-yl)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(3,8-dimethyl-1,2-dioxaspiro[4.5]decan-3-yl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 44562720 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 3-(3,8-dimethyl-1,2-dioxaspiro[4.5]decan-3-yl)-2,2-dimethylpropan-1-ol |
| SMILES | CC1CCC2(CC1)CC(C)(CC(C)(C)CO)OO2 |
| InChI | InChI=1S/C15H28O3/c1-12-5-7-15(8-6-12)10-14(4,17-18-15)9-13(2,3)11-16/h12,16H,5-11H2,1-4H3 |
| InChIKey | NQQLHLMZPCUSHU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|