About 2-ethyladamantan-2-amine;hydrochloride
2-ethyladamantan-2-amine;hydrochloride (PubChem CID 44562805) has the molecular formula C12H22ClN
and a molecular weight of 215.77 g/mol. Its IUPAC name is 2-ethyladamantan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-ethyladamantan-2-amine;hydrochloride |
| PubChem CID | 44562805 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 2-ethyladamantan-2-amine;hydrochloride |
| SMILES | CCC1(N)C2CC3CC(C2)CC1C3.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8;/h8-11H,2-7,13H2,1H3;1H |
| InChIKey | JKDUTNHREIIDCM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyladamantan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyladamantan-2-amine;hydrochloride?
The IUPAC name of 2-ethyladamantan-2-amine;hydrochloride (CID 44562805) is 2-ethyladamantan-2-amine;hydrochloride.
What is the SMILES notation for 2-ethyladamantan-2-amine;hydrochloride?
The canonical SMILES for 2-ethyladamantan-2-amine;hydrochloride is CCC1(N)C2CC3CC(C2)CC1C3.Cl.
What is the InChIKey of 2-ethyladamantan-2-amine;hydrochloride?
The InChIKey is JKDUTNHREIIDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.ClH/c1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8;/h8-11H,2-7,13H2,1H3;1H.
What are the key properties of 2-ethyladamantan-2-amine;hydrochloride?
2-ethyladamantan-2-amine;hydrochloride has a molecular weight of 215.77 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyladamantan-2-amine;hydrochloride is sourced from PubChem (CID 44562805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).