About 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one
1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one (PubChem CID 44562853) has the molecular formula C30H31N3O2
and a molecular weight of 465.60 g/mol. Its IUPAC name is 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one.
Molecular Properties
| Compound Name | 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one |
| PubChem CID | 44562853 |
| Molecular Formula | C30H31N3O2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one |
| SMILES | Cc1ccc(C2C(C)C(=O)C(C)C(c3ccc(C)cc3)N2C(=O)Cn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C30H31N3O2/c1-19-9-13-23(14-10-19)28-21(3)30(35)22(4)29(24-15-11-20(2)12-16-24)33(28)27(34)17-32-18-31-25-7-5-6-8-26(25)32/h5-16,18,21-22,28-29H,17H2,1-4H3 |
| InChIKey | KMNOSTLBPLPSEO-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one?
The IUPAC name of 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one (CID 44562853) is 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one.
What is the SMILES notation for 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one?
The canonical SMILES for 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one is Cc1ccc(C2C(C)C(=O)C(C)C(c3ccc(C)cc3)N2C(=O)Cn2cnc3ccccc32)cc1.
What is the InChIKey of 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one?
The InChIKey is KMNOSTLBPLPSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H31N3O2/c1-19-9-13-23(14-10-19)28-21(3)30(35)22(4)29(24-15-11-20(2)12-16-24)33(28)27(34)17-32-18-31-25-7-5-6-8-26(25)32/h5-16,18,21-22,28-29H,17H2,1-4H3.
What are the key properties of 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one?
1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one has a molecular weight of 465.60 g/mol, XLogP of 5.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(benzimidazol-1-yl)acetyl]-3,5-dimethyl-2,6-bis(4-methylphenyl)piperidin-4-one is sourced from PubChem (CID 44562853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).