About 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one
5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one (PubChem CID 44562906) has the molecular formula C18H15ClN6O
and a molecular weight of 366.81 g/mol. Its IUPAC name is 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one |
| PubChem CID | 44562906 |
| Molecular Formula | C18H15ClN6O |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(Nc3ncc(Cl)c(NCc4ccccn4)n3)ccc2N1 |
| InChI | InChI=1S/C18H15ClN6O/c19-14-10-22-18(25-17(14)21-9-13-3-1-2-6-20-13)23-12-4-5-15-11(7-12)8-16(26)24-15/h1-7,10H,8-9H2,(H,24,26)(H2,21,22,23,25) |
| InChIKey | GIEASVWUYRFSSI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one?
The IUPAC name of 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one (CID 44562906) is 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one?
The canonical SMILES for 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one is O=C1Cc2cc(Nc3ncc(Cl)c(NCc4ccccn4)n3)ccc2N1.
What is the InChIKey of 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one?
The InChIKey is GIEASVWUYRFSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN6O/c19-14-10-22-18(25-17(14)21-9-13-3-1-2-6-20-13)23-12-4-5-15-11(7-12)8-16(26)24-15/h1-7,10H,8-9H2,(H,24,26)(H2,21,22,23,25).
What are the key properties of 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one?
5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one has a molecular weight of 366.81 g/mol, XLogP of 3.38, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-chloro-4-(pyridin-2-ylmethylamino)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one is sourced from PubChem (CID 44562906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).