About 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane
3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane (PubChem CID 44562927) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane |
| PubChem CID | 44562927 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane |
| SMILES | CC1CCC2(CC1)CC(C)(CCOCc1ccccc1)OO2 |
| InChI | InChI=1S/C19H28O3/c1-16-8-10-19(11-9-16)15-18(2,21-22-19)12-13-20-14-17-6-4-3-5-7-17/h3-7,16H,8-15H2,1-2H3 |
| InChIKey | ZVVAXGLDDNTAMB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane?
The IUPAC name of 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane (CID 44562927) is 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane.
What is the SMILES notation for 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane?
The canonical SMILES for 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane is CC1CCC2(CC1)CC(C)(CCOCc1ccccc1)OO2.
What is the InChIKey of 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane?
The InChIKey is ZVVAXGLDDNTAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O3/c1-16-8-10-19(11-9-16)15-18(2,21-22-19)12-13-20-14-17-6-4-3-5-7-17/h3-7,16H,8-15H2,1-2H3.
What are the key properties of 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane?
3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane has a molecular weight of 304.43 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-3-(2-phenylmethoxyethyl)-1,2-dioxaspiro[4.5]decane is sourced from PubChem (CID 44562927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).