About 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide
2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide (PubChem CID 44562972) has the molecular formula C24H29NO3
and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide |
| PubChem CID | 44562972 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide |
| SMILES | CC1(CC(=O)NCc2ccc(-c3ccccc3)cc2)CC2(CCCCC2)OO1 |
| InChI | InChI=1S/C24H29NO3/c1-23(18-24(28-27-23)14-6-3-7-15-24)16-22(26)25-17-19-10-12-21(13-11-19)20-8-4-2-5-9-20/h2,4-5,8-13H,3,6-7,14-18H2,1H3,(H,25,26) |
| InChIKey | CEBOIAHQPQFNRQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide?
The IUPAC name of 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide (CID 44562972) is 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide.
What is the SMILES notation for 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide?
The canonical SMILES for 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide is CC1(CC(=O)NCc2ccc(-c3ccccc3)cc2)CC2(CCCCC2)OO1.
What is the InChIKey of 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide?
The InChIKey is CEBOIAHQPQFNRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO3/c1-23(18-24(28-27-23)14-6-3-7-15-24)16-22(26)25-17-19-10-12-21(13-11-19)20-8-4-2-5-9-20/h2,4-5,8-13H,3,6-7,14-18H2,1H3,(H,25,26).
What are the key properties of 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide?
2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide has a molecular weight of 379.50 g/mol, XLogP of 5.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-dioxaspiro[4.5]decan-3-yl)-N-[(4-phenylphenyl)methyl]acetamide is sourced from PubChem (CID 44562972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).