C40H41BrN2O2 — CID 44563002
2-benzyl-7-butoxy-1-[(E)-2-(4-methoxyphenyl)ethenyl]-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide (PubChem CID 44563002) has the molecular formula C40H41BrN2O2 and a molecular weight of 661.68 g/mol. Its IUPAC name is 2-benzyl-7-butoxy-1-[(E)-2-(4-methoxyphenyl)ethenyl]-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide.
| Compound Name | 2-benzyl-7-butoxy-1-[(E)-2-(4-methoxyphenyl)ethenyl]-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide |
|---|---|
| PubChem CID | 44563002 |
| Molecular Formula | C40H41BrN2O2 |
| Molecular Weight | 661.68 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 2-benzyl-7-butoxy-1-[(E)-2-(4-methoxyphenyl)ethenyl]-9-(3-phenylpropyl)pyrido[3,4-b]indol-2-ium bromide |
| SMILES | CCCCOc1ccc2c3cc[n+](Cc4ccccc4)c(/C=C/c4ccc(OC)cc4)c3n(CCCc3ccccc3)c2c1.[Br-] |
| InChI | InChI=1S/C40H41N2O2.BrH/c1-3-4-28-44-35-22-23-36-37-25-27-41(30-33-14-9-6-10-15-33)38(24-19-32-17-20-34(43-2)21-18-32)40(37)42(39(36)29-35)26-11-16-31-12-7-5-8-13-31;/h5-10,12-15,17-25,27,29H,3-4,11,16,26,28,30H2,1-2H3;1H/q+1;/p-1/b24-19+; |
| InChIKey | ZEIGNMDJUCTOJC-UUWMJBOLSA-M |
| XLogP | 6.12 |
| TPSA | 27.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|