C31H28O11 — CID 44563014
2-(3,4-dihydroxyphenyl)-4-[7-(3,4-dihydroxyphenyl)-2,4,6-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 44563014) has the molecular formula C31H28O11 and a molecular weight of 576.55 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-4-[7-(3,4-dihydroxyphenyl)-2,4,6-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | 2-(3,4-dihydroxyphenyl)-4-[7-(3,4-dihydroxyphenyl)-2,4,6-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 44563014 |
| Molecular Formula | C31H28O11 |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-4-[7-(3,4-dihydroxyphenyl)-2,4,6-trihydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2c1c(O)cc(O)c2c1CC(c1ccc(O)c(O)c1)C(O)C2 |
| InChI | InChI=1S/C31H28O11/c32-14-7-24(39)28-26(8-14)42-31(13-2-4-19(34)23(38)6-13)30(41)29(28)27-17-9-15(12-1-3-18(33)22(37)5-12)20(35)10-16(17)21(36)11-25(27)40/h1-8,11,15,20,29-41H,9-10H2 |
| InChIKey | XMIJRXVCFAOTEG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 211.53 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|