C21H23Cl2N3O — CID 44563217
(1S,13R,15S)-6,7-dichloro-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4,6,8-tetraen-20-one (PubChem CID 44563217) has the molecular formula C21H23Cl2N3O and a molecular weight of 404.34 g/mol. Its IUPAC name is (1S,13R,15S)-6,7-dichloro-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4,6,8-tetraen-20-one.
| Compound Name | (1S,13R,15S)-6,7-dichloro-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4,6,8-tetraen-20-one |
|---|---|
| PubChem CID | 44563217 |
| Molecular Formula | C21H23Cl2N3O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (1S,13R,15S)-6,7-dichloro-12,12-dimethyl-10,19,21-triazahexacyclo[13.5.2.01,13.03,11.04,9.015,19]docosa-3(11),4,6,8-tetraen-20-one |
| SMILES | CC1(C)c2[nH]c3cc(Cl)c(Cl)cc3c2C[C@@]23NC[C@]4(CCCN4C2=O)C[C@H]13 |
| InChI | InChI=1S/C21H23Cl2N3O/c1-19(2)16-9-20-4-3-5-26(20)18(27)21(16,24-10-20)8-12-11-6-13(22)14(23)7-15(11)25-17(12)19/h6-7,16,24-25H,3-5,8-10H2,1-2H3/t16-,20+,21+/m1/s1 |
| InChIKey | RHXYWMKZOPEVBY-CZAAIQMYSA-N |
| XLogP | 4.03 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |