C26H39NO3 — CID 44563288
(5Z,8Z,11Z,14Z)-19-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]nonadeca-5,8,11,14-tetraenamide (PubChem CID 44563288) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-19-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]nonadeca-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-19-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]nonadeca-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 44563288 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-19-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]nonadeca-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCc1ccco1 |
| InChI | InChI=1S/C26H39NO3/c1-24(23-28)27-26(29)21-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-19-25-20-18-22-30-25/h2,4-5,7-8,10-11,13,18,20,22,24,28H,3,6,9,12,14-17,19,21,23H2,1H3,(H,27,29)/b4-2-,7-5-,10-8-,13-11-/t24-/m1/s1 |
| InChIKey | BWDVKBYRMLPLCI-OJZQPWLLSA-N |
| XLogP | 6.05 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|