C27H41NO3 — CID 44563289
(5Z,8Z,11Z,14Z)-20-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]icosa-5,8,11,14-tetraenamide (PubChem CID 44563289) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-20-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-20-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 44563289 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-20-(furan-2-yl)-N-[(2R)-1-hydroxypropan-2-yl]icosa-5,8,11,14-tetraenamide |
| SMILES | C[C@H](CO)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCc1ccco1 |
| InChI | InChI=1S/C27H41NO3/c1-25(24-29)28-27(30)22-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-20-26-21-19-23-31-26/h2-3,6-9,12,14,19,21,23,25,29H,4-5,10-11,13,15-18,20,22,24H2,1H3,(H,28,30)/b3-2-,8-6-,9-7-,14-12-/t25-/m1/s1 |
| InChIKey | OJPRRHVDGAPBDL-BXMGUHIDSA-N |
| XLogP | 6.44 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|